
CAS 1325306-18-0
:Methyl 3-amino-4-(3-chlorophenyl)-2-thiophenecarboxylate
Description:
Methyl 3-amino-4-(3-chlorophenyl)-2-thiophenecarboxylate is an organic compound characterized by its complex structure, which includes a thiophene ring, an amino group, and a chlorophenyl substituent. The presence of the thiophene moiety contributes to its aromatic properties and potential reactivity, while the amino group can participate in hydrogen bonding and nucleophilic reactions. The chlorophenyl group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and solubility. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of pharmaceuticals or agrochemicals. Additionally, the methyl ester functionality indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, further expanding its chemical utility. Overall, Methyl 3-amino-4-(3-chlorophenyl)-2-thiophenecarboxylate is a versatile compound with potential applications in various fields of chemistry.
Formula:C12H10ClNO2S
InChI:InChI=1S/C12H10ClNO2S/c1-16-12(15)11-10(14)9(6-17-11)7-3-2-4-8(13)5-7/h2-6H,14H2,1H3
InChI key:InChIKey=QLOBEPXSOQXRBY-UHFFFAOYSA-N
SMILES:NC=1C(=CSC1C(OC)=O)C2=CC(Cl)=CC=C2
Synonyms:- Methyl 3-amino-4-(3-chlorophenyl)-2-thiophenecarboxylate
- 2-Thiophenecarboxylic acid, 3-amino-4-(3-chlorophenyl)-, methyl ester
- 3-Amino-4-(3-chloro-phenyl)-thiophene-2-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.