CAS 13254-04-1

N-[(Phenylmethoxy)carbonyl]-L-isoleucylglycine

Description:

N-[(Phenylmethoxy)carbonyl]-L-isoleucylglycine, with the CAS number 13254-04-1, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a phenylmethoxycarbonyl group, which enhances its stability and solubility in various solvents. The presence of the isoleucyl and glycine residues contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of peptide-based drugs. The compound is characterized by its specific stereochemistry, as indicated by the L-configuration of isoleucine, which is crucial for its interaction with biological systems. Additionally, it may exhibit properties such as moderate to high melting points and solubility in polar organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the design of inhibitors or modulators of biological pathways. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its potential applications.

Formula: C₁₆H₂₂N₂O₅

InChI: InChI=1S/C16H22N2O5/c1-3-11(2)14(15(21)17-9-13(19)20)18-16(22)23-10-12-7-5-4-6-8-12/h4-8,11,14H,3,9-10H2,1-2H3,(H,17,21)(H,18,22)(H,19,20)/t11-,14-/m0/s1

InChI key: InChIKey=RWAYODJQGJVQGX-FZMZJTMJSA-N

SMILES: [C@@H](C(NCC(O)=O)=O)([C@H](CC)C)NC(OCC1=CC=CC=C1)=O

Synonyms:

• N-[(Phenylmethoxy)carbonyl]-L-isoleucylglycine
• Glycine, N-(N-carboxy-L-isoleucyl)-, N-benzyl ester
• Glycine, N-[N-[(phenylmethoxy)carbonyl]-L-isoleucyl]-
• Glycine, N-[(phenylmethoxy)carbonyl]-L-isoleucyl-