CAS 132557-73-4
:3H-Indole-5-sulfonic acid, 2,3,3-trimethyl-, compd. with N,N-diethylethanamine (1:1)
Description:
3H-Indole-5-sulfonic acid, 2,3,3-trimethyl-, compd. with N,N-diethylethanamine (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a sulfonic acid group enhances its solubility in water and contributes to its acidic properties. The trimethyl substitution at the 2,3,3 positions of the indole ring indicates that it has bulky groups that may influence its steric and electronic properties. The compound is paired with N,N-diethylethanamine, a tertiary amine, which can affect its overall basicity and reactivity. This combination suggests potential applications in various fields, including pharmaceuticals and biochemistry, where such compounds may serve as intermediates or active ingredients. The specific interactions between the indole sulfonic acid and the amine can lead to unique properties, making it of interest for further research and development in synthetic chemistry and medicinal applications.
Formula:C11H13NO3S·C6H15N
InChI:InChI=1S/C11H13NO3S.C6H15N/c1-7-11(2,3)9-6-8(16(13,14)15)4-5-10(9)12-7;1-4-7(5-2)6-3/h4-6H,1-3H3,(H,13,14,15);4-6H2,1-3H3
InChI key:InChIKey=OEXSMDPSRPJDIB-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(N=C1C)=CC=C(S(=O)(=O)O)C2.N(CC)(CC)CC
Synonyms:- 3H-Indole-5-sulfonic acid, 2,3,3-trimethyl-
- 3H-Indole-5-sulfonic acid, 2,3,3-trimethyl-, compd. with N,N-diethylethanamine (1:1)
- 5-Sulfo-2,3,3-Trimethylindolenine
- 5-Sulfo-2,3,3-trimethyl indolenine
- 2,3,3-Trimethyl-3H-indole-5-sulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3,3-trimethyl-3H-indole-5-sulfonic acid, N,N-diethylethanamine (1:1)
CAS:Formula:C17H28N2O3SColor and Shape:SolidMolecular weight:340.4808
