
CAS 132559-92-3
:4-Azido-6-methyl-2H-pyran-2-one
Description:
4-Azido-6-methyl-2H-pyran-2-one is a chemical compound characterized by its azido functional group and a pyranone structure. It features a six-membered ring containing both oxygen and nitrogen atoms, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the azido group (-N3) makes it a useful intermediate in click chemistry, allowing for the formation of various derivatives through reactions such as azide-alkyne cycloaddition. The methyl group at the 6-position enhances its lipophilicity, potentially influencing its biological activity and solubility. This compound may exhibit interesting properties such as fluorescence or photochemical reactivity, making it valuable in research settings. However, due to the presence of the azido group, it may also pose safety concerns, as azides can be sensitive and potentially explosive under certain conditions. Overall, 4-Azido-6-methyl-2H-pyran-2-one is a versatile compound with significant implications in synthetic chemistry and material science.
Formula:C6H5N3O2
InChI:InChI=1S/C6H5N3O2/c1-4-2-5(8-9-7)3-6(10)11-4/h2-3H,1H3
InChI key:InChIKey=LEWYVSQLKLJMGF-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C=1C=C(C)OC(=O)C1
Synonyms:- 2H-Pyran-2-one, 4-azido-6-methyl-
- 4-Azido-6-methyl-2H-pyran-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.