
CAS 132560-69-1
:(1-Ethenyl-1,5-dimethyl-4-hexen-1-yl)benzene
Description:
(1-Ethenyl-1,5-dimethyl-4-hexen-1-yl)benzene, also known by its CAS number 132560-69-1, is an organic compound characterized by its complex structure that includes both a benzene ring and a long aliphatic chain. This compound features a vinyl group, which contributes to its reactivity, particularly in polymerization reactions. The presence of multiple methyl groups and a hexene moiety indicates that it has a branched structure, which can influence its physical properties such as boiling point, melting point, and solubility. Typically, compounds of this nature are hydrophobic due to their hydrocarbon chains, making them less soluble in water but more soluble in organic solvents. Additionally, the compound may exhibit interesting chemical behavior, including potential applications in organic synthesis or as a precursor in the production of more complex molecules. Its reactivity and structural features make it a subject of interest in fields such as materials science and organic chemistry. Safety data and handling precautions should be considered when working with this compound, as with any chemical substance.
Formula:C16H22
InChI:InChI=1S/C16H22/c1-5-16(4,13-9-10-14(2)3)15-11-7-6-8-12-15/h5-8,10-12H,1,9,13H2,2-4H3
InChI key:InChIKey=NHMUKDSFOSGYPA-UHFFFAOYSA-N
SMILES:C(CCC=C(C)C)(C=C)(C)C1=CC=CC=C1
Synonyms:- (1-Ethenyl-1,5-dimethyl-4-hexen-1-yl)benzene
- 3,7-Dimethyl-3-phenyl-1,6-octadiene
- Benzene, (1-ethenyl-1,5-dimethyl-4-hexenyl)-
- Benzene, (1-ethenyl-1,5-dimethyl-4-hexen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
