
CAS 13257-82-4
:3-Methyl-4-[(trimethylsilyl)oxy]-3-penten-2-one
Description:
3-Methyl-4-[(trimethylsilyl)oxy]-3-penten-2-one, with the CAS number 13257-82-4, is an organic compound characterized by its unique structure that includes a pentenone backbone and a trimethylsilyl ether functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its volatility and low viscosity. The presence of the trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various chemical reactions, particularly in organic synthesis and as a reagent in the preparation of other compounds. Its reactivity is influenced by the conjugated double bonds in the pentenone structure, allowing for electrophilic addition and other transformations. Additionally, this compound may exhibit properties such as moderate polarity and a relatively low boiling point, which are common in similar organic molecules. Safety data should be consulted for handling and storage, as it may pose hazards typical of organic solvents and reactive chemicals.
Formula:C9H18O2Si
InChI:InChI=1S/C9H18O2Si/c1-7(8(2)10)9(3)11-12(4,5)6/h1-6H3
InChI key:InChIKey=APYCEWMOBDTBJX-UHFFFAOYSA-N
SMILES:C(=C(C(C)=O)C)(O[Si](C)(C)C)C
Synonyms:- 3-Penten-2-one, 3-methyl-4-[(trimethylsilyl)oxy]-
- 3-Methyl-4-[(trimethylsilyl)oxy]-3-penten-2-one
- 3-Penten-2-one, 3-methyl-4-(trimethylsiloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
