CAS 1325724-92-2

1-(3,4-Dichlorophenyl)-1H-1,2,3-triazole-4-carboxaldehyde

Description:

1-(3,4-Dichlorophenyl)-1H-1,2,3-triazole-4-carboxaldehyde is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which contributes to its potential biological activity and lipophilicity. The aldehyde functional group (-CHO) attached to the triazole ring enhances its reactivity, making it useful in various synthetic applications. The presence of the triazole moiety often imparts antifungal and antimicrobial properties, making this compound of interest in pharmaceutical research. Additionally, the dichlorophenyl substituent may influence the compound's electronic properties and interactions with biological targets. Overall, this compound's unique structure and functional groups suggest potential applications in medicinal chemistry and agrochemicals, warranting further investigation into its properties and activities.

Formula: C₉H₅Cl₂N₃O

InChI: InChI=1S/C9H5Cl2N3O/c10-8-2-1-7(3-9(8)11)14-4-6(5-15)12-13-14/h1-5H

InChI key: InChIKey=CDVNHFMDFXOJIM-UHFFFAOYSA-N

SMILES: C(=O)C1=CN(N=N1)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• 1-(3,4-Dichlorophenyl)-1H-1,2,3-triazole-4-carboxaldehyde
• 1H-1,2,3-Triazole-4-carboxaldehyde, 1-(3,4-dichlorophenyl)-
• 1-(3,4-Dichlorophenyl)-1H-1,2,3-triazole-4-carbaldehyde

1-(3,4-Dichlorophenyl)-1H-1,2,3-triazole-4-carbaldehyde

CAS: 1325724-92-2

Versatile small molecule scaffold

Formula: C₉H₅Cl₂N₃O

Purity: Min. 95%

Molecular weight: 242.06 g/mol

Ref: 3D-ADC72492