CymitQuimica logo

CAS 1325724-93-3

:

1-(2,5-Dichlorophenyl)-1H-1,2,3-triazole-4-carboxaldehyde

Description:
1-(2,5-Dichlorophenyl)-1H-1,2,3-triazole-4-carboxaldehyde is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on the phenyl ring, which can influence its reactivity and biological activity. The aldehyde functional group (-CHO) at the 4-position of the triazole ring contributes to its potential as a reactive intermediate in various chemical reactions, including condensation and nucleophilic addition. The presence of chlorine substituents typically enhances lipophilicity and can affect the compound's pharmacokinetic properties. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and agrochemical research. Its unique structure allows for potential applications in drug development, particularly in targeting specific biological pathways or as a building block for more complex molecules. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H5Cl2N3O
InChI:InChI=1S/C9H5Cl2N3O/c10-6-1-2-8(11)9(3-6)14-4-7(5-15)12-13-14/h1-5H
InChI key:InChIKey=VQGMWWGNZNNIKZ-UHFFFAOYSA-N
SMILES:ClC1=C(N2C=C(C=O)N=N2)C=C(Cl)C=C1
Synonyms:
  • 1-(2,5-Dichlorophenyl)-1H-1,2,3-triazole-4-carbaldehyde
  • 1-(2,5-Dichlorophenyl)-1H-1,2,3-triazole-4-carboxaldehyde
  • 1H-1,2,3-Triazole-4-carboxaldehyde, 1-(2,5-dichlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.