CAS 132584-12-4
:(5S)-5-Methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-2,4-oxazolidinedione
Description:
(5S)-5-Methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-2,4-oxazolidinedione, with CAS number 132584-12-4, is a synthetic organic compound characterized by its oxazolidinedione structure, which features a five-membered ring containing nitrogen and oxygen atoms. This compound exhibits chirality, with the (5S) designation indicating the specific stereochemistry at the carbon atom bearing the methyl group. It contains multiple functional groups, including a phenylamino group and a phenoxy group, which contribute to its potential biological activity and solubility properties. The presence of these aromatic groups may enhance its interactions with biological targets, making it of interest in medicinal chemistry. Additionally, oxazolidinediones are known for their applications in pharmaceuticals, particularly as antibacterial agents. The compound's molecular structure suggests it may exhibit unique pharmacological properties, although specific biological activities would require empirical investigation. Overall, this compound represents a class of molecules that could be explored for therapeutic applications, particularly in the context of drug development.
Formula:C22H18N2O4
InChI:InChI=1S/C22H18N2O4/c1-22(16-12-14-19(15-13-16)27-18-10-6-3-7-11-18)20(25)24(21(26)28-22)23-17-8-4-2-5-9-17/h2-15,23H,1H3/t22-/m0/s1
InChI key:InChIKey=PCCSBWNGDMYFCW-QFIPXVFZSA-N
SMILES:C[C@@]1(C(=O)N(NC2=CC=CC=C2)C(=O)O1)C3=CC=C(OC4=CC=CC=C4)C=C3
Synonyms:- 2,4-Oxazolidinedione, 5-methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-, (S)-
- (5S)-5-Methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-2,4-oxazolidinedione
- (S)-Famoxadone
- 2,4-Oxazolidinedione, 5-methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-, (5S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(S)-Famoxadone
CAS:(S)-Famoxadone is an analog of the anticancer drug tolvaptan that has been shown to have potent inhibitory effects on cancer cell growth. It induces apoptosis in Chinese hamster ovary cells and human tumor cells by inhibiting kinases, which are proteins that play a key role in cell proliferation and survival. (S)-Famoxadone acts as a potent inhibitor of protein kinase inhibitors, which are involved in the regulation of cell growth and division. This drug has also been shown to inhibit the activity of certain enzymes involved in urine production. Its potential as an anticancer agent makes it a promising candidate for further study.Formula:C22H18N2O4Purity:Min. 95%Molecular weight:374.4 g/mol

