
CAS 132587-63-4
:3-Methoxy-1-methyl-2-propyl-4(1H)-quinolinone
Description:
3-Methoxy-1-methyl-2-propyl-4(1H)-quinolinone, identified by its CAS number 132587-63-4, is a chemical compound belonging to the quinolinone class, which is characterized by a fused bicyclic structure containing a quinoline moiety. This compound features a methoxy group and a propyl chain, contributing to its unique properties and potential biological activities. Quinolinones are known for their diverse pharmacological effects, including antimicrobial, anti-inflammatory, and anticancer activities. The presence of the methoxy and propyl substituents can influence the compound's solubility, stability, and interaction with biological targets. Typically, such compounds are studied for their potential therapeutic applications, and their synthesis often involves multi-step organic reactions. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility can vary based on the purity and specific conditions under which the compound is handled. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C14H17NO2
InChI:InChI=1S/C14H17NO2/c1-4-7-12-14(17-3)13(16)10-8-5-6-9-11(10)15(12)2/h5-6,8-9H,4,7H2,1-3H3
InChI key:InChIKey=GEGKYZYCKNLWLI-UHFFFAOYSA-N
SMILES:CN1C=2C(C(=O)C(OC)=C1CCC)=CC=CC2
Synonyms:- Leiokinine A
- 3-Methoxy-1-methyl-2-propyl-4(1H)-quinolinone
- 4(1H)-Quinolinone, 3-methoxy-1-methyl-2-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Leiokinine A
CAS:<p>Leiokinine A is a novel 4-quinolinone alkaloid.</p>Formula:C14H17NO2Color and Shape:SolidMolecular weight:231.29
