CAS 132605-19-7
:3-methyl-2-thioxo-1,2,3,5,6,7-hexahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one
Description:
3-Methyl-2-thioxo-1,2,3,5,6,7-hexahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both thieno and pyrimidin moieties. The presence of a thioxo group contributes to its reactivity and potential biological activity. This compound features a methyl group at the 3-position, which can influence its solubility and interaction with biological targets. Its hexahydro structure indicates that it is saturated, which may affect its stability and reactivity compared to unsaturated analogs. The compound's unique arrangement of sulfur and nitrogen atoms within the ring system suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the presence of multiple functional groups may allow for diverse chemical modifications, enhancing its utility in various chemical reactions. Overall, this compound exemplifies the complexity and diversity found in heterocyclic chemistry, with implications for both synthetic and applied chemistry fields.
Formula:C10H10N2OS2
InChI:InChI=1/C10H10N2OS2/c1-12-9(13)7-5-3-2-4-6(5)15-8(7)11-10(12)14/h2-4H2,1H3,(H,11,14)
SMILES:Cn1c(=O)c2c3CCCc3sc2nc1S
Synonyms:- 4H-Cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one, 1,2,3,5,6,7-hexahydro-3-methyl-2-thioxo-
- 4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one, 3,5,6,7-tetrahydro-2-mercapto-3-methyl-
- 3-Methyl-2-thioxo-1,2,3,5,6,7-hexahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-mercapto-3-methyl-3,5,6,7-tetrahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one
CAS:Molecular weight:238.32000732421875
