CymitQuimica logo

CAS 132605-23-3

:

3-methyl-5-phenyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one

Description:
3-Methyl-5-phenyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its complex structure, which includes a thieno-pyrimidine core. This compound features a thioxo group, contributing to its reactivity and potential biological activity. The presence of a methyl group and a phenyl group enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The thieno[2,3-d]pyrimidine framework is known for its diverse pharmacological properties, making this compound of interest in medicinal chemistry. Its CAS number, 132605-23-3, allows for easy identification in chemical databases. The compound may exhibit various properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be required to confirm these effects. Overall, the unique structural features of 3-methyl-5-phenyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one suggest potential applications in drug development and research.
Formula:C13H10N2OS2
InChI:InChI=1/C13H10N2OS2/c1-15-12(16)10-9(8-5-3-2-4-6-8)7-18-11(10)14-13(15)17/h2-7H,1H3,(H,14,17)
SMILES:Cn1c(=O)c2c(csc2nc1S)c1ccccc1
Synonyms:
  • 2-Mercapto-3-methyl-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.