CAS 132605-28-8

3-ethyl-5-phenyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one

Description:

3-Ethyl-5-phenyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its unique structural features, which include a thieno[2,3-d]pyrimidine core. This compound contains a thioxo group, contributing to its reactivity and potential biological activity. The presence of an ethyl group and a phenyl group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The thieno[2,3-d]pyrimidine framework is known for its pharmacological properties, making this compound of interest in medicinal chemistry. It may exhibit various biological activities, including antimicrobial or anticancer effects, although specific biological data would depend on empirical studies. The compound's molecular structure suggests potential for further derivatization, which could lead to the development of novel therapeutic agents. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental conditions such as pH and temperature. Overall, 3-ethyl-5-phenyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one represents a class of compounds with significant potential in pharmaceutical applications.

Formula: C₁₄H₁₂N₂OS₂

InChI: InChI=1/C14H12N2OS2/c1-2-16-13(17)11-10(9-6-4-3-5-7-9)8-19-12(11)15-14(16)18/h3-8H,2H2,1H3,(H,15,18)

SMILES: CCn1c(=O)c2c(csc2nc1S)c1ccccc1

Synonyms:

• 3-Ethyl-2-mercapto-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one
• 3-Ethyl-5-phenyl-2-sulfanylthieno[2,3-d]pyrimidin-4(3H)-one
• thieno[2,3-d]pyrimidin-4(1H)-one, 3-ethyl-2,3-dihydro-5-phenyl-2-thioxo-
• thieno[2,3-d]pyrimidin-4(3H)-one, 3-ethyl-2-mercapto-5-phenyl-
• 3-Ethyl-5-phenyl-2-thioxo-2,3-dihydrothieno[2,3-d]pyrimidin-4(1H)-one