CAS 13261-51-3

5-Amino-2-naphthalenesulfonamide

Description:

5-Amino-2-naphthalenesulfonamide, with the CAS number 13261-51-3, is an organic compound characterized by its sulfonamide functional group and an amino group attached to a naphthalene ring system. This compound typically appears as a solid and is known for its solubility in polar solvents, which is influenced by the presence of the sulfonamide group. It exhibits properties such as being a weak acid due to the sulfonamide moiety, and it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, as sulfonamides are known for their antibacterial properties. Additionally, it may serve as a building block in the synthesis of more complex organic molecules. Safety data indicates that, like many sulfonamides, it should be handled with care, as it may cause allergic reactions in sensitive individuals. Overall, 5-Amino-2-naphthalenesulfonamide is a versatile compound with significant relevance in both research and application.

Formula: C₁₀H₁₀N₂O₂S

InChI: InChI=1S/C10H10N2O2S/c11-10-3-1-2-7-6-8(15(12,13)14)4-5-9(7)10/h1-6H,11H2,(H2,12,13,14)

InChI key: InChIKey=VHBNXFLPOPMZEV-UHFFFAOYSA-N

SMILES: NC=1C2=C(C=C(S(N)(=O)=O)C=C2)C=CC1

Synonyms:

• 5-Amino-2-naphthalenesulfonamide
• 2-Naphthalenesulfonamide, 5-amino-