CAS 13262-48-1
:N-[1,1′-Biphenyl]-4-ylurea
Description:
N-[1,1′-Biphenyl]-4-ylurea, with the CAS number 13262-48-1, is an organic compound characterized by its urea functional group attached to a biphenyl moiety. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents. It exhibits properties that make it useful in various chemical applications, including as a building block in organic synthesis and potentially in pharmaceutical research. The biphenyl structure contributes to its stability and can influence its electronic properties, making it relevant in studies related to molecular interactions and material science. Additionally, the presence of the urea group can facilitate hydrogen bonding, which may enhance its reactivity and solubility in polar solvents. Overall, N-[1,1′-Biphenyl]-4-ylurea is a compound of interest in both academic and industrial chemistry due to its unique structural features and potential applications.
Formula:C13H12N2O
InChI:InChI=1S/C13H12N2O/c14-13(16)15-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H3,14,15,16)
InChI key:InChIKey=FAVOSJNIJZMFAB-UHFFFAOYSA-N
SMILES:N(C(N)=O)C1=CC=C(C=C1)C2=CC=CC=C2
Synonyms:- (4-Phenylphenyl)urea
- 1-Biphenyl-4-Ylurea
- Ai3-20179
- N-[1,1′-Biphenyl]-4-ylurea
- NSC 406090
- Urea, (1,1'-biphenyl)-4-yl-
- Urea, (4-biphenylyl)-
- Urea, N-[1,1′-biphenyl]-4-yl-
- Biphenyl-4-ylurea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Urea, N-[1,1'-biphenyl]-4-yl-
CAS:Formula:C13H12N2OPurity:97%Color and Shape:SolidMolecular weight:212.2472Biphenyl-4-ylurea
CAS:Biphenyl-4-ylurea is a biochemical.Formula:C13H12N2OColor and Shape:SolidMolecular weight:212.25(4-Phenylphenyl)urea
CAS:The molecular formula of 4-Phenylphenyl)urea is C8H7N3O2 and its molecular weight is 186.19 g/mol. The chemical name for 4-Phenylphenyl)urea is (4-phenylphenyl) urea. It has a melting point of 192°C, a boiling point of 334°C, and a density of 1.12 g/cm3. 4-Phenylphenyl)urea crystallizes in the orthorhombic system with space group Pbca and lattice constants a = 8.068 Å, b = 7.957 Å, c = 12.096 Å and β = 116°. It has hydrogen bonds to water molecules as well as to itself through hydrogen bonds with the amide NH groups on the urea moiety and the phenyl ring on one molecule forming hydrogen bonds with other phenyl rings on adjacent molecules.Formula:C13H12N2OPurity:Min. 95%Molecular weight:212.25 g/mol



