CymitQuimica logo

CAS 132622-86-7

:

1,2-Pyrrolidinedicarboxylic acid, 4-(aminomethyl)-, 1-(1,1-dimethylethyl) ester, (2R-cis)-

Description:
1,2-Pyrrolidinedicarboxylic acid, 4-(aminomethyl)-, 1-(1,1-dimethylethyl) ester, (2R-cis)-, with CAS number 132622-86-7, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features two carboxylic acid groups and an aminomethyl substituent, contributing to its potential as a versatile building block in organic synthesis. The presence of the tert-butyl ester group enhances its lipophilicity, making it more soluble in organic solvents. The (2R-cis) configuration indicates specific stereochemistry, which can influence its reactivity and interaction with biological systems. This compound may exhibit properties such as being a potential ligand in coordination chemistry or a precursor in the synthesis of pharmaceuticals. Its unique structure allows for various applications in medicinal chemistry, agrochemicals, and materials science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H20N2O4
InChI:InChI=1S/C11H20N2O4/c1-11(2,3)17-10(16)13-6-7(5-12)4-8(13)9(14)15/h7-8H,4-6,12H2,1-3H3,(H,14,15)/t7-,8+/m0/s1
InChI key:InChIKey=VWFCKAANOBELKO-JGVFFNPUSA-N
SMILES:C(OC(C)(C)C)(=O)N1[C@@H](C(O)=O)C[C@@H](CN)C1
Synonyms:
  • 1,2-Pyrrolidinedicarboxylic acid, 4-(aminomethyl)-, 1-(1,1-dimethylethyl) ester, (2R-cis)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.