
CAS 132631-86-8
:1-Methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1H-pyrazol-5-amine
Description:
1-Methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1H-pyrazol-5-amine is a fluorinated organic compound characterized by its complex structure, which includes a pyrazole ring substituted with various fluorinated groups. The presence of multiple fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential stability against metabolic degradation. This compound is likely to exhibit high thermal stability and may have low volatility due to the strong C-F bonds. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in areas requiring specific biological activity or selectivity. The presence of the trifluoromethyl group and the pentafluoroethyl substituent may enhance its reactivity and interaction with biological targets. Additionally, the compound's solubility and behavior in various solvents can be influenced by the fluorinated groups, making it of interest for studies in medicinal chemistry and materials science. Safety and handling considerations are essential due to the toxicity associated with some fluorinated compounds.
Formula:C7H5F8N3
InChI:InChI=1S/C7H5F8N3/c1-18-4(16)2(6(10,11)12)3(17-18)5(8,9)7(13,14)15/h16H2,1H3
InChI key:InChIKey=ULWCNDONUYLJNQ-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(F)(F)C=1C(C(F)(F)F)=C(N)N(C)N1
Synonyms:- 1H-Pyrazol-5-amine, 1-methyl-3-(pentafluoroethyl)-4-(trifluoromethyl)-
- 1H-Pyrazol-5-amine, 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-
- 2-Methyl-5-pentafluoroethyl-4-trifluoromethyl-2H-pyrazol-3-ylamine
- 1-Methyl-3-(pentafluoroethyl)-4-(trifluoromethyl)-1H-pyrazol-5-amine
- 1-Methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1H-pyrazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.