CAS 132636-15-8

Benzenemethanaminium, N,N,N-tris(phenylmethyl)-, bromide (1:1)

Description:

Benzenemethanaminium, N,N,N-tris(phenylmethyl)-, bromide (1:1), commonly referred to as a quaternary ammonium compound, exhibits several notable characteristics. This substance features a central nitrogen atom bonded to three phenylmethyl groups and a bromide ion, which contributes to its ionic nature. The presence of multiple phenyl groups imparts significant hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound is typically used in various applications, including as a surfactant, in phase transfer catalysis, and in the synthesis of other organic compounds. Its quaternary ammonium structure often leads to antimicrobial properties, making it useful in biocidal formulations. Additionally, the bromide ion can participate in nucleophilic substitution reactions, enhancing its reactivity in organic synthesis. Overall, the unique combination of hydrophobic and ionic characteristics makes this compound versatile in both industrial and research settings.

Formula: C₂₈H₂₈N·Br

InChI: InChI=1S/C28H28N.BrH/c1-5-13-25(14-6-1)21-29(22-26-15-7-2-8-16-26,23-27-17-9-3-10-18-27)24-28-19-11-4-12-20-28;/h1-20H,21-24H2;1H/q+1;/p-1

InChI key: InChIKey=KBOPQCLKSDUBAZ-UHFFFAOYSA-M

SMILES: [N+](CC1=CC=CC=C1)(CC2=CC=CC=C2)(CC3=CC=CC=C3)CC4=CC=CC=C4.[Br-]

Synonyms:

• Benzenemethanaminium, N,N,N-tris(phenylmethyl)-, bromide
• Tetrabenzylammonium bromide
• Benzenemethanaminium, N,N,N-tris(phenylmethyl)-, bromide (1:1)

Benzenemethanaminium, N,N,N-tris(phenylmethyl)-, bromide (1:1)

CAS: 132636-15-8

Formula: C₂₈H₂₈BrN

Molecular weight: 458.4326

Ref: IN-DA0010XK