
CAS 13265-58-2
:4,4,5,5,6,6,6-Heptafluorohexanenitrile
Description:
4,4,5,5,6,6,6-Heptafluorohexanenitrile, with the CAS number 13265-58-2, is a fluorinated organic compound characterized by the presence of a hexane backbone substituted with multiple fluorine atoms and a nitrile functional group. This compound typically exhibits high thermal stability and low reactivity due to the strong C-F bonds, which contribute to its resistance to oxidation and degradation. The presence of the nitrile group (-C≡N) imparts polar characteristics, enhancing its solubility in polar solvents while limiting its solubility in nonpolar environments. Additionally, the fluorinated nature of the compound often results in unique properties such as low surface tension and high hydrophobicity. These characteristics make it of interest in various applications, including specialty chemicals, solvents, and potentially in the field of materials science. However, due to the environmental concerns associated with fluorinated compounds, its use may be subject to regulatory scrutiny.
Formula:C6H4F7N
InChI:InChI=1S/C6H4F7N/c7-4(8,2-1-3-14)5(9,10)6(11,12)13/h1-2H2
InChI key:InChIKey=LDQFRFBCYMGCSZ-UHFFFAOYSA-N
SMILES:C(C(CCC#N)(F)F)(C(F)(F)F)(F)F
Synonyms:- Hexanenitrile, 4,4,5,5,6,6,6-heptafluoro-
- 4,4,5,5,6,6,6-Heptafluorohexanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.