CymitQuimica logo

CAS 132664-85-8

:

2-(AMINOMETHYL)-5-METHYLPYRAZINE

Description:
2-(Aminomethyl)-5-methylpyrazine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features an amino group (-NH2) attached to a methylene bridge (-CH2-) and a methyl group (-CH3) on the pyrazine ring, contributing to its unique chemical properties. It is typically a colorless to light yellow liquid or solid, depending on its physical state at room temperature. The presence of the amino group makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, its structure suggests potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The compound's solubility in polar solvents and its reactivity with electrophiles can be influenced by the electron-donating nature of the amino group and the electron-withdrawing characteristics of the pyrazine ring. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H9N3
InChI:InChI=1/C6H9N3/c1-5-3-9-6(2-7)4-8-5/h3-4H,2,7H2,1H3
InChI key:MPBCUCGKHDEUDD-UHFFFAOYSA-N
SMILES:Cc1cnc(CN)cn1
Synonyms:
  • 2-(Aminomethyl)-5-Methylpyrazine 97%
  • 1-(5-Methylpyrazin-2-Yl)Methanamine
Found 5 products.