CymitQuimica logo

CAS 132669-28-4

:

3-chloro-N-(3,4-difluorophenyl)propanamide

Description:
3-Chloro-N-(3,4-difluorophenyl)propanamide is a chemical compound characterized by its amide functional group, which is indicative of its potential applications in pharmaceuticals and agrochemicals. The presence of a chloro substituent and a difluorophenyl group contributes to its unique reactivity and biological activity. This compound typically exhibits moderate to high polarity due to the presence of electronegative halogens and the amide bond, which can influence its solubility in various solvents. The difluorophenyl moiety may enhance lipophilicity and biological interactions, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential for hydrogen bonding, which can affect its melting and boiling points. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure. Overall, 3-chloro-N-(3,4-difluorophenyl)propanamide is a compound of interest for further research, particularly in the context of drug development and material science.
Formula:C9H8ClF2NO
InChI:InChI=1/C9H8ClF2NO/c10-4-3-9(14)13-6-1-2-7(11)8(12)5-6/h1-2,5H,3-4H2,(H,13,14)
SMILES:c1cc(c(cc1N=C(CCCl)O)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.