CAS 132670-09-8
:3-Thiopheneacetic acid, ethyl ester, homopolymer
Description:
3-Thiopheneacetic acid, ethyl ester, homopolymer is a synthetic polymer derived from the polymerization of thiophene-based monomers. This compound features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, contributing to its unique electronic properties and potential applications in organic electronics and conductive materials. The presence of the ethyl ester group enhances its solubility and processability, making it suitable for various applications in coatings, adhesives, and as a precursor for more complex materials. The polymer's characteristics, such as thermal stability, mechanical strength, and conductivity, can vary depending on its molecular weight and degree of polymerization. Additionally, the thiophene units can facilitate π-π stacking interactions, which are beneficial for charge transport in electronic applications. Overall, this polymer exhibits interesting properties that make it a subject of research in fields like organic semiconductors and materials science.
Formula:(C8H10O2S)x
InChI:InChI=1S/C8H10O2S/c1-2-10-8(9)5-7-3-4-11-6-7/h3-4,6H,2,5H2,1H3
InChI key:InChIKey=FZBNQIWPYCUPAP-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C=1C=CSC1
Synonyms:- Poly(thiophene-3-ethyl acetate)
- 3-Thiopheneacetic acid, ethyl ester, homopolymer
- Poly(ethyl thiophene-3-acetate)
- Ethyl 3-thiopheneacetate homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
