CymitQuimica logo

CAS 1326713-71-6

:

2,3-Dichloro-4-iodofuro[2,3-c]pyridin-7-amine

Description:
2,3-Dichloro-4-iodofuro[2,3-c]pyridin-7-amine is a heterocyclic organic compound characterized by its complex structure, which includes a fused pyridine and furan ring system. The presence of two chlorine atoms and one iodine atom introduces significant halogenation, which can influence the compound's reactivity and biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions. Its unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, the halogen substituents can enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its interaction with biological targets. Overall, 2,3-Dichloro-4-iodofuro[2,3-c]pyridin-7-amine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C7H3Cl2IN2O
InChI:InChI=1S/C7H3Cl2IN2O/c8-4-3-2(10)1-12-7(11)5(3)13-6(4)9/h1H,(H2,11,12)
InChI key:InChIKey=SVWPUFPJPSSMRP-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=C(N)N=CC2I)OC1Cl
Synonyms:
  • Furo[2,3-c]pyridin-7-amine, 2,3-dichloro-4-iodo-
  • 2,3-Dichloro-4-iodofuro[2,3-c]pyridin-7-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.