CymitQuimica logo

CAS 1326714-51-5

:

3-Bromo-2-fluoro-5-nitrobenzaldehyde

Description:
3-Bromo-2-fluoro-5-nitrobenzaldehyde is an aromatic compound characterized by the presence of a benzaldehyde functional group, which features a carbonyl group (–CHO) directly attached to a benzene ring. This compound contains three substituents on the benzene ring: a bromine atom at the 3-position, a fluorine atom at the 2-position, and a nitro group (–NO2) at the 5-position. These substituents contribute to its chemical reactivity and physical properties. The presence of the electron-withdrawing nitro group enhances the electrophilic character of the benzaldehyde, making it more reactive in nucleophilic addition reactions. The bromine and fluorine atoms introduce halogen characteristics, influencing the compound's solubility and polarity. 3-Bromo-2-fluoro-5-nitrobenzaldehyde is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique combination of functional groups allows for diverse chemical transformations, making it a valuable compound in synthetic organic chemistry.
Formula:C7H3BrFNO3
InChI:InChI=1S/C7H3BrFNO3/c8-6-2-5(10(12)13)1-4(3-11)7(6)9/h1-3H
InChI key:InChIKey=CAOZIMCATDOANH-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(N(=O)=O)=CC(Br)=C1F
Synonyms:
  • Benzaldehyde, 3-bromo-2-fluoro-5-nitro-
  • 3-Bromo-2-fluoro-5-nitrobenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.