CymitQuimica logo

CAS 1326714-81-1

:

3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carbonitrile

Description:
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carbonitrile is a chemical compound characterized by its unique structural features, which include an indole moiety and a dioxaborolane group. The presence of the carbonitrile functional group indicates that it possesses a cyano group, contributing to its potential reactivity and applications in organic synthesis. The dioxaborolane component is notable for its ability to participate in various chemical reactions, particularly in the formation of boron-containing compounds, which are valuable in medicinal chemistry and materials science. This compound may exhibit properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its specific applications could range from serving as an intermediate in the synthesis of pharmaceuticals to acting as a building block in the development of novel materials. Overall, the combination of these functional groups suggests that this compound could be of interest in both academic research and industrial applications.
Formula:C15H17BN2O2
InChI:InChI=1S/C15H17BN2O2/c1-14(2)15(3,4)20-16(19-14)12-9-18-13-7-10(8-17)5-6-11(12)13/h5-7,9,18H,1-4H3
InChI key:InChIKey=DYSIBACARWSJOT-UHFFFAOYSA-N
SMILES:CC1(C)OB(C=2C=3C(NC2)=CC(C#N)=CC3)OC1(C)C
Synonyms:
  • 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carbonitrile
  • 1H-Indole-6-carbonitrile, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.