CAS 132680-54-7

6-methoxyisoindolinone

Description:

6-Methoxyisoindolinone is a chemical compound characterized by its isoindolinone structure, which features a fused benzene and pyrrolidinone ring system. This compound is typically recognized for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its bioactive properties. The presence of the methoxy group at the 6-position enhances its solubility and may influence its interaction with biological targets. It is generally a white to off-white solid, and its molecular formula reflects the presence of carbon, hydrogen, nitrogen, and oxygen atoms. The compound may exhibit various functional properties, including potential anti-inflammatory and neuroprotective effects, making it of interest in research related to neurological disorders. Additionally, its synthesis often involves multi-step organic reactions, highlighting its relevance in synthetic organic chemistry. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₉H₉NO₂

InChI: InChI=1/C9H9NO2/c1-12-7-3-2-6-5-10-9(11)8(6)4-7/h2-4H,5H2,1H3,(H,10,11)

SMILES: COc1ccc2CN=C(c2c1)O

Synonyms:

• 6-Methoxyisoindolin-1-One
• 5-methoxy-2,3-dihydro-1H-isoindol-1-one
• 6-methoxy-2,3-dihydro-1H-isoindol-1-one
• 1H-Isoindol-1-one, 2,3-dihydro-6-methoxy-

1H-Isoindol-1-one, 2,3-dihydro-6-methoxy-

CAS: 132680-54-7

Formula: C₉H₉NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.1733

Ref: IN-DA0010YW

6-Methoxyisoindolin-1-one

CAS: 132680-54-7

6-Methoxyisoindolin-1-one

Formula: C₉H₉NO₂

Purity: 97%

Color and Shape: off white (hint of cream/beige). wooly solid

Molecular weight: 163.17g/mol

Ref: 54-OR305281

6-Methoxyisoindolinone

CAS: 132680-54-7

Formula: C₉H₉NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.176

Ref: 10-F035892