CAS 1326806-72-7

3-[(3-Chlorophenyl)sulfonyl]-6,7-difluoro-1-(phenylmethyl)-4(1H)-quinolinone

Description:

3-[(3-Chlorophenyl)sulfonyl]-6,7-difluoro-1-(phenylmethyl)-4(1H)-quinolinone is a synthetic organic compound characterized by its complex molecular structure, which includes a quinolinone core substituted with a sulfonyl group and multiple fluorine atoms. The presence of the 3-chlorophenyl group contributes to its potential biological activity, while the difluoro substituents enhance its chemical stability and lipophilicity. This compound is typically studied for its pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the quinolinone scaffold can lead to compounds with varied therapeutic effects. Its sulfonyl group may also play a role in interactions with biological targets, making it a candidate for further research in drug development. The compound's solubility, melting point, and reactivity would depend on its specific functional groups and overall molecular geometry, which are critical for understanding its behavior in biological systems and potential applications in pharmaceuticals.

Formula: C₂₂H₁₄ClF₂NO₃S

InChI: InChI=1S/C22H14ClF2NO3S/c23-15-7-4-8-16(9-15)30(28,29)21-13-26(12-14-5-2-1-3-6-14)20-11-19(25)18(24)10-17(20)22(21)27/h1-11,13H,12H2

InChI key: InChIKey=BOPMSYMWKBFMAQ-UHFFFAOYSA-N

SMILES: C(N1C=2C(C(=O)C(S(=O)(=O)C3=CC(Cl)=CC=C3)=C1)=CC(F)=C(F)C2)C4=CC=CC=C4

Synonyms:

• 4(1H)-Quinolinone, 3-[(3-chlorophenyl)sulfonyl]-6,7-difluoro-1-(phenylmethyl)-
• 3-[(3-Chlorophenyl)sulfonyl]-6,7-difluoro-1-(phenylmethyl)-4(1H)-quinolinone