CAS 1326814-72-5

4-(3,4,5-Trimethoxybenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid

Description:

4-(3,4,5-Trimethoxybenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both an oxa and azaspiro framework. This compound features a benzoyl moiety with three methoxy groups, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the carboxylic acid functional group suggests that it may exhibit acidic properties, allowing for potential interactions in biological systems. The spiro structure contributes to its rigidity, which can affect its conformational behavior and reactivity. Additionally, the methoxy groups may participate in hydrogen bonding and influence solubility in various solvents. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₉H₂₅NO₇

InChI: InChI=1S/C19H25NO7/c1-24-14-9-12(10-15(25-2)16(14)26-3)17(21)20-13(18(22)23)11-27-19(20)7-5-4-6-8-19/h9-10,13H,4-8,11H2,1-3H3,(H,22,23)

InChI key: InChIKey=JKSXFHYNJOPVLX-UHFFFAOYSA-N

SMILES: C(=O)(N1C2(OCC1C(O)=O)CCCCC2)C3=CC(OC)=C(OC)C(OC)=C3

Synonyms:

• 4-(3,4,5-Trimethoxybenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid
• 1-Oxa-4-azaspiro[4.5]decane-3-carboxylic acid, 4-(3,4,5-trimethoxybenzoyl)-

4-(3,4,5-trimethoxybenzoyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid

CAS: 1326814-72-5

Purity: 95.0%

Molecular weight: 379.40899658203125

Ref: 10-F525526