
CAS 132685-14-4
:P-[1-(Acetylamino)ethyl]phosphonic acid
Description:
P-[1-(Acetylamino)ethyl]phosphonic acid, with the CAS number 132685-14-4, is a phosphonic acid derivative characterized by the presence of a phosphonic acid functional group and an acetylamino substituent. This compound typically exhibits properties associated with phosphonic acids, such as high solubility in polar solvents and the ability to form stable complexes with metal ions. It is likely to be a zwitterionic species at physiological pH due to the presence of both acidic and basic functional groups. The acetylamino group contributes to its potential biological activity, possibly influencing its interaction with biological systems. This compound may be of interest in agricultural chemistry, particularly as a plant growth regulator or herbicide, due to its structural similarity to naturally occurring plant hormones. Additionally, its unique chemical structure may allow for specific applications in pharmaceuticals or as a biochemical probe. Overall, P-[1-(Acetylamino)ethyl]phosphonic acid represents a versatile compound with potential utility in various fields of chemistry and biology.
Formula:C4H10NO4P
InChI:InChI=1S/C4H10NO4P/c1-3(6)5-4(2)10(7,8)9/h4H,1-2H3,(H,5,6)(H2,7,8,9)
InChI key:InChIKey=OWNNFWRGXJDEEX-UHFFFAOYSA-N
SMILES:C(NC(C)=O)(P(=O)(O)O)C
Synonyms:- P-[1-(Acetylamino)ethyl]phosphonic acid
- Phosphonic acid, [1-(acetylamino)ethyl]-
- Phosphonic acid, P-[1-(acetylamino)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
