CAS 13269-86-8

1,1′-Oxybis[1,2,2-trifluoroethene]

Description:

1,1′-Oxybis[1,2,2-trifluoroethene], with the CAS number 13269-86-8, is a fluorinated organic compound characterized by its unique structure, which includes two trifluoroethene units connected by an ether linkage. This compound is notable for its high degree of fluorination, which imparts significant chemical stability and low reactivity, making it resistant to degradation under various conditions. It typically exists as a colorless liquid or solid, depending on the temperature, and has a low volatility due to its strong C-F bonds. The presence of fluorine atoms enhances its hydrophobic properties, making it useful in applications requiring water repellency. Additionally, its unique electronic properties may contribute to its potential use in specialized materials, such as coatings or polymers. However, due to the environmental concerns associated with fluorinated compounds, its use may be subject to regulatory scrutiny. Overall, 1,1′-Oxybis[1,2,2-trifluoroethene] exemplifies the characteristics of fluorinated compounds, combining stability with unique physical and chemical properties.

Formula: C₄F₆O

InChI: InChI=1S/C4F6O/c5-1(6)3(9)11-4(10)2(7)8

InChI key: InChIKey=RRZIJNVZMJUGTK-UHFFFAOYSA-N

SMILES: C(OC(=C(F)F)F)(=C(F)F)F

Synonyms:

• 1,1,2-Trifluoro-2-[(Trifluoroethenyl)Oxy]Ethene
• 1,1′-Oxybis[1,2,2-trifluoroethene]
• Bis(trifluorovinyl) ether
• Ethene, 1,1′-oxybis[1,2,2-trifluoro-
• Ether, bis(trifluorovinyl)
• Perfluorovinylether
• 1,1'-Oxybis(1,2,2-trifluoroethylene)

Ethene, 1,1'-oxybis[1,2,2-trifluoro-

CAS: 13269-86-8

Formula: C₄F₆O

Molecular weight: 178.0326

Ref: IN-DA00110B