
CAS 132692-49-0
:Cyanic acid, C,C′-[1,3-phenylenebis[(1-methylethylidene)-4,1-phenylene]] ester, homopolymer
Description:
Cyanic acid, C,C′-[1,3-phenylenebis[(1-methylethylidene)-4,1-phenylene]] ester, homopolymer, identified by CAS number 132692-49-0, is a synthetic polymer characterized by its unique chemical structure that includes cyanate ester functionalities. This polymer exhibits high thermal stability and excellent mechanical properties, making it suitable for applications in high-performance materials, particularly in aerospace and electronics. The presence of phenylene groups contributes to its rigidity and strength, while the cyanate ester linkages enhance its resistance to heat and chemical degradation. Additionally, this polymer can undergo cross-linking, which further improves its dimensional stability and thermal resistance. Its processing typically involves methods such as molding or extrusion, and it can be cured to form a thermoset material. Overall, this polymer is valued for its combination of thermal stability, mechanical strength, and chemical resistance, making it a versatile choice in advanced material applications.
Formula:(C26H24N2O2)x
InChI:InChI=1S/C26H24N2O2/c1-25(2,19-8-12-23(13-9-19)29-17-27)21-6-5-7-22(16-21)26(3,4)20-10-14-24(15-11-20)30-18-28/h5-16H,1-4H3
InChI key:InChIKey=QODYBLNVIHQJIW-UHFFFAOYSA-N
SMILES:C(C)(C)(C1=CC(C(C)(C)C2=CC=C(OC#N)C=C2)=CC=C1)C3=CC=C(OC#N)C=C3
Synonyms:- Cyanic acid, 1,3-phenylenebis[(1-methylethylidene)-4,1-phenylene] ester, homopolymer
- Cyanic acid, C,C′-[1,3-phenylenebis[(1-methylethylidene)-4,1-phenylene]] ester, homopolymer
- RTX 366 homopolymer
- XU 378
- AroCy XU 378
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyanic acid, C,C′-[1,3-phenylenebis[(1-methylethylidene)-4,1-phenylene]] ester, homopolymer
CAS:Formula:C26H24N2O2Molecular weight:396.4810
