
CAS 1326923-23-2
:1-(4-Chloro-3-methylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid
Description:
1-(4-Chloro-3-methylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a chloro substituent on the aromatic ring enhances its biological activity and may influence its solubility and interaction with other molecules. The methyl groups attached to both the triazole and the phenyl ring can affect the compound's steric properties and overall stability. This substance may exhibit various pharmacological properties, making it of interest in medicinal chemistry and agricultural applications. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods. As with many triazole derivatives, it may also possess antifungal or antibacterial properties, which are common in compounds containing this structural motif.
Formula:C11H10ClN3O2
InChI:InChI=1S/C11H10ClN3O2/c1-6-5-8(3-4-9(6)12)15-7(2)10(11(16)17)13-14-15/h3-5H,1-2H3,(H,16,17)
InChI key:InChIKey=JBBSLHMNENMDJI-UHFFFAOYSA-N
SMILES:CC=1N(N=NC1C(O)=O)C2=CC(C)=C(Cl)C=C2
Synonyms:- 1-(4-Chloro-3-methylphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid
- 1H-1,2,3-Triazole-4-carboxylic acid, 1-(4-chloro-3-methylphenyl)-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.