CymitQuimica logo

CAS 132696-47-0

:

(αR)-α-[[[(Phenylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid

Description:
The chemical substance known as (αR)-α-[[[(Phenylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid, with the CAS number 132696-47-0, is a compound that belongs to the class of amino acids and derivatives. It features a chiral center, which contributes to its stereochemical properties, specifically the (αR) configuration. This compound is characterized by the presence of a phenylmethoxy group, which enhances its lipophilicity and may influence its biological activity. The carboxylic acid functional group is indicative of its acidic nature, while the amine group suggests potential for forming peptide bonds. Its structure implies that it may participate in various chemical reactions, including esterification and amidation. Additionally, due to its complex structure, it may exhibit specific interactions with biological targets, making it of interest in pharmaceutical research. Overall, this compound's unique characteristics, including its stereochemistry and functional groups, position it as a potentially valuable molecule in medicinal chemistry and drug development.
Formula:C18H19NO4
InChI:InChI=1S/C18H19NO4/c20-17(21)16(11-14-7-3-1-4-8-14)12-19-18(22)23-13-15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,19,22)(H,20,21)/t16-/m1/s1
InChI key:InChIKey=FCMHQDUEDVBCNC-MRXNPFEDSA-N
SMILES:C([C@H](CNC(OCC1=CC=CC=C1)=O)C(O)=O)C2=CC=CC=C2
Synonyms:
  • (αR)-α-[[[(Phenylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid
  • Benzenepropanoic acid, α-[[[(phenylmethoxy)carbonyl]amino]methyl]-, (αR)-
  • (R)-2-Benzyl-3-(benzyloxycarbonylamino)propanoic acid
  • Benzenepropanoic acid, α-[[[(phenylmethoxy)carbonyl]amino]methyl]-, (R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.