CAS 13270-97-8
:3,5-Diphenyloctamethyltetrasiloxane
Description:
3,5-Diphenyloctamethyltetrasiloxane, with the CAS number 13270-97-8, is a siloxane compound characterized by its unique structure that includes multiple phenyl groups and a siloxane backbone. This compound typically exhibits properties such as low viscosity, thermal stability, and resistance to oxidation, making it suitable for various applications in the fields of materials science and chemical engineering. Its siloxane framework contributes to flexibility and durability, while the phenyl groups enhance its thermal and UV stability. Additionally, 3,5-Diphenyloctamethyltetrasiloxane may demonstrate hydrophobic characteristics, which can be advantageous in coatings and sealants. The presence of multiple methyl groups in its structure can also influence its reactivity and compatibility with other materials. Overall, this compound is of interest for its potential use in high-performance applications, including lubricants, adhesives, and as a component in silicone-based formulations. However, specific applications and safety considerations should be evaluated based on regulatory guidelines and material safety data sheets.
Formula:C20H34O3Si4
InChI:InChI=1/C20H34O3Si4/c1-24(2,3)21-26(7,19-15-11-9-12-16-19)23-27(8,22-25(4,5)6)20-17-13-10-14-18-20/h9-18H,1-8H3
SMILES:C[Si](C)(C)O[Si](C)(c1ccccc1)O[Si](C)(c1ccccc1)O[Si](C)(C)C
Synonyms:- 1,1,1,3,5,7,7,7-Octamethyl-3,5-Diphenyltetrasiloxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1,1,3,5,7,7,7-Octamethyl-3,5-diphenyltetrasiloxane
CAS:Formula:C20H34O3Si4Molecular weight:434.8242
