CymitQuimica logo

CAS 132706-15-1

:

α-Ethyl-5-methyl-2-thiophenemethanol

Description:
α-Ethyl-5-methyl-2-thiophenemethanol, with the CAS number 132706-15-1, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an ethyl group and a methyl group attached to the thiophene ring, contributing to its unique chemical properties. The presence of the hydroxyl (-OH) group indicates that it is an alcohol, which can influence its solubility and reactivity. Generally, compounds like this may exhibit interesting biological activities, making them of interest in medicinal chemistry and materials science. The thiophene moiety can also participate in various chemical reactions, such as electrophilic substitutions, due to its electron-rich nature. Additionally, the compound's physical properties, such as boiling point and melting point, would be influenced by the functional groups and the overall molecular structure. However, specific data regarding its reactivity, stability, and applications would require further investigation through experimental studies or literature reviews.
Formula:C8H12OS
InChI:InChI=1S/C8H12OS/c1-3-7(9)8-5-4-6(2)10-8/h4-5,7,9H,3H2,1-2H3
InChI key:InChIKey=VRGMFMZEASMTIW-UHFFFAOYSA-N
SMILES:C(CC)(O)C=1SC(C)=CC1
Synonyms:
  • α-Ethyl-5-methyl-2-thiophenemethanol
  • 1-(5-Methyl-2-thienyl)-1-propanol
  • 2-Thiophenemethanol, α-ethyl-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.