CAS 132710-79-3
:4-Piperidinol, 1-methyl-, 4-(4-methylbenzenesulfonate)
Description:
4-Piperidinol, 1-methyl-, 4-(4-methylbenzenesulfonate), commonly referred to as a piperidine derivative, is characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a methyl group at the 1-position and a sulfonate group attached to a para-substituted methylbenzene at the 4-position, contributing to its solubility and reactivity. The presence of the sulfonate group enhances its potential as a leaving group in various chemical reactions, making it useful in synthetic organic chemistry. Additionally, the compound may exhibit properties typical of piperidine derivatives, such as basicity and the ability to form hydrogen bonds, which can influence its interactions with biological systems. Its applications may extend to pharmaceuticals, where such derivatives are often explored for their biological activity. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H19NO3S
InChI:InChI=1S/C13H19NO3S/c1-11-3-5-13(6-4-11)18(15,16)17-12-7-9-14(2)10-8-12/h3-6,12H,7-10H2,1-2H3
InChI key:InChIKey=SHXBDIPVBFVOMK-UHFFFAOYSA-N
SMILES:S(OC1CCN(C)CC1)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:- 4-Piperidinol, 1-methyl-, 4-(4-methylbenzenesulfonate)
- 1-Methylpiperidin-4-yl 4-methylbenzene-1-sulfonate
- NSC 177947
- 4-Piperidinol, 1-methyl-, 4-methylbenzenesulfonate (ester)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.