CAS 132712-10-8
:4-butyroxybenzenediazonium fluoroborate
Description:
4-Butyroxybenzenediazonium fluoroborate is a chemical compound characterized by its diazonium functional group, which is known for its reactivity and utility in organic synthesis, particularly in azo coupling reactions. The presence of the butyroxy group enhances its solubility and stability in various solvents. This compound typically appears as a solid and is sensitive to light and heat, necessitating careful handling and storage conditions to prevent decomposition. Its fluoroborate counterion contributes to its solubility in polar solvents, making it useful in various chemical applications. The diazonium group allows for electrophilic substitution reactions, enabling the introduction of various substituents onto aromatic rings. However, due to its reactive nature, it must be handled with caution, as diazonium salts can be hazardous and potentially explosive under certain conditions. Overall, 4-butyroxybenzenediazonium fluoroborate serves as a valuable intermediate in synthetic organic chemistry, particularly in the development of dyes and pigments.
Formula:C10H11BF4N2O2
InChI:InChI=1/C10H11N2O2.BF4/c1-2-3-10(13)14-9-6-4-8(12-11)5-7-9;2-1(3,4)5/h4-7H,2-3H2,1H3;/q+1;-1
Synonyms:- 4-Bbdf
- p-Butyroxybenzenediazonium fluoroborate
- 4-(Butanoyloxy)Benzenediazonium Tetrafluoroborate
- 4-Butyroxybenzenediazonium fluoroborate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenediazonium, 4-(1-oxobutoxy)-, tetrafluoroborate(1-) (1:1)
CAS:Formula:C10H11BF4N2O2Molecular weight:278.0112
