CAS 132712-53-9
:4,4-bis(4-fluorophenyl)butanoic acid
Description:
4,4-bis(4-fluorophenyl)butanoic acid, with the CAS number 132712-53-9, is an organic compound characterized by its unique structure, which features a butanoic acid backbone substituted with two 4-fluorophenyl groups. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The carboxylic acid functional group imparts acidic characteristics, allowing for potential interactions in biological systems or with other chemical entities. Additionally, the compound's molecular symmetry and the presence of multiple aromatic rings may contribute to its stability and reactivity. Overall, 4,4-bis(4-fluorophenyl)butanoic acid is a compound of interest due to its structural features and potential applications, warranting further investigation into its properties and uses.
Formula:C16H14F2O2
InChI:InChI=1/C16H14F2O2/c17-12-7-5-11(6-8-12)13(9-10-16(19)20)14-3-1-2-4-15(14)18/h1-8,13H,9-10H2,(H,19,20)
SMILES:c1ccc(c(c1)C(CCC(=O)O)c1ccc(cc1)F)F
Synonyms:- Bfba
- Benzenebutanoic acid, 2-fluoro-gamma-(4-fluorophenyl)-
- 4-(2-Fluorophenyl)-4-(4-Fluorophenyl)Butanoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
