CAS 132722-90-8
:9-(2',3'-dideoxy-2'-fluoroarabinofuranosyl)purine
Description:
9-(2',3'-Dideoxy-2'-fluoroarabinofuranosyl)purine, also known by its abbreviation as 2'-F-ara-A, is a nucleoside analog that exhibits antiviral properties, particularly against certain viruses such as HIV. This compound features a purine base linked to a modified sugar moiety, specifically an arabinofuranosyl structure that has been altered by the removal of hydroxyl groups at the 2' and 3' positions and the introduction of a fluorine atom at the 2' position. These modifications enhance its stability and bioavailability, making it a valuable candidate in antiviral therapy. The presence of the fluorine atom contributes to its resistance to enzymatic degradation, which is a common challenge in nucleoside-based drugs. Additionally, 2'-F-ara-A can interfere with viral replication by mimicking natural nucleosides, thereby inhibiting viral polymerases. Its unique structural characteristics and mechanism of action make it an important compound in the field of medicinal chemistry and virology, particularly in the development of treatments for viral infections.
Formula:C10H11FN4O2
InChI:InChI=1/C10H11FN4O2/c11-7-1-6(3-16)17-10(7)15-5-14-8-2-12-4-13-9(8)15/h2,4-7,10,16H,1,3H2/t6-,7-,10+/m0/s1
Synonyms:- 2'-F-Ara-ddp
- 9-(2,3-Dideoxy-2-fluoro-beta-D-threo-pentafuranosyl)-9H-purine
- 9H-Purine, 9-(2,3-dideoxy-2-fluoro-beta-D-threo-pentafuranosyl)-
- 9-(2,3-dideoxy-2-fluoro-beta-D-threo-pentofuranosyl)-9H-purine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.