CAS 132723-93-4

1-Benzyl-1,4,8,11-tetraazacyclotetradecane

Description:

1-Benzyl-1,4,8,11-tetraazacyclotetradecane, identified by its CAS number 132723-93-4, is a cyclic polyamine characterized by a tetraazacyclotetradecane framework, which consists of a 14-membered ring containing four nitrogen atoms. This compound features a benzyl group attached to one of the nitrogen atoms, enhancing its solubility and reactivity. The presence of multiple nitrogen atoms contributes to its chelating properties, making it a potential ligand for metal ions in coordination chemistry. The structure allows for flexibility and conformational changes, which can influence its interaction with various substrates. Additionally, the compound may exhibit interesting biological activities, including potential applications in drug delivery or as a therapeutic agent, due to its ability to form stable complexes with metal ions. Its synthesis typically involves multi-step organic reactions, and it is important to handle it with care, considering the potential hazards associated with nitrogen-containing compounds. Overall, 1-benzyl-1,4,8,11-tetraazacyclotetradecane represents a unique class of compounds with diverse applications in chemistry and materials science.

Formula: C₁₇H₃₀N₄

InChI: InChI=1/C17H30N4/c1-2-6-17(7-3-1)16-21-14-5-10-19-12-11-18-8-4-9-20-13-15-21/h1-3,6-7,18-20H,4-5,8-16H2

SMILES: c1ccc(cc1)CN1CCCNCCNCCCNCC1

Synonyms:

• N-Benzyl-1,4,8,11-tetraazacyclotetradecane, min. 98%

1,4,8,11-Tetraazacyclotetradecane, 1-(phenylmethyl)-

CAS: 132723-93-4

Formula: C₁₇H₃₀N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 290.4469

Ref: IN-DA00112B

N-Benzyl-1,4,8,11-tetraaza­cyclotetradecane, min. 98%

CAS: 132723-93-4

N-Benzyl-1,4,8,11-tetraazacyclotetradecane, min. 98%

Formula: C₁₇H₃₀N₄

Purity: min. 98%

Color and Shape: white to yellow pwdr.

Molecular weight: 290.45

Ref: 08-07-1957