CAS 13273-53-5

4-bromo-1-methyl-1H-1,2,3-triazole

Description:

4-Bromo-1-methyl-1H-1,2,3-triazole is a heterocyclic compound characterized by its five-membered ring structure containing three nitrogen atoms and two carbon atoms. The presence of a bromine atom at the 4-position and a methyl group at the 1-position contributes to its unique chemical properties. This compound is typically a white to light yellow solid and is soluble in polar organic solvents. It exhibits a range of reactivity due to the presence of the triazole ring, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. 4-Bromo-1-methyl-1H-1,2,3-triazole is often utilized in organic synthesis and medicinal chemistry, serving as a building block for more complex molecules. Its derivatives may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and methyl substituents, which can affect its interactions in various chemical environments.

Formula: C₃H₄BrN₃

InChI: InChI=1/C3H4BrN3/c1-7-2-3(4)5-6-7/h2H,1H3

SMILES: Cn1cc(Br)nn1

4-Bromo-1-methyl-1H-1,2,3-triazole

CAS: 13273-53-5

Formula: C₃H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.9880

Ref: IN-DA00112I

4-Bromo-1-methyl-1H-1,2,3-triazole

CAS: 13273-53-5

4-Bromo-1-methyl-1H-1,2,3-triazole

Formula: C₃H₄BrN₃

Purity: 98%

Color and Shape: yellow solid

Molecular weight: 161.99g/mol

Ref: 54-OR301020

4-Bromo-1-methyl-1H-1,2,3-triazole

CAS: 13273-53-5

Formula: C₃H₄BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.99

Ref: 10-F209306