CAS 13273-85-3
:2,5,5-Trimethyl-2-(3-methylbutyl)-1,3-dioxane
Description:
2,5,5-Trimethyl-2-(3-methylbutyl)-1,3-dioxane is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound is a derivative of dioxane, specifically modified with multiple alkyl groups, including trimethyl and 3-methylbutyl substituents. These substituents contribute to its hydrophobic nature and influence its physical properties, such as boiling point and solubility. Typically, compounds like this may exhibit moderate volatility and can be used in various applications, including as solvents or intermediates in organic synthesis. The presence of multiple methyl groups can enhance the compound's stability and steric hindrance, potentially affecting its reactivity. Additionally, due to its complex structure, it may exhibit unique interactions in chemical reactions, making it of interest in both industrial and research settings. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C12H24O2
InChI:InChI=1S/C12H24O2/c1-10(2)6-7-12(5)13-8-11(3,4)9-14-12/h10H,6-9H2,1-5H3
InChI key:InChIKey=KJWBXOPQYZIDPU-UHFFFAOYSA-N
SMILES:C(CC(C)C)C1(C)OCC(C)(C)CO1
Synonyms:- m-Dioxane, 2-isopentyl-2,5,5-trimethyl-
- 2,5,5-Trimethyl-2-(3-methylbutyl)-1,3-dioxane
- 1,3-Dioxane, 2,5,5-trimethyl-2-(3-methylbutyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
