CymitQuimica logo

CAS 1327366-68-6

:

4H-Pyrrolo[2,3-d]thiazole-5-methanol

Description:
4H-Pyrrolo[2,3-d]thiazole-5-methanol is a heterocyclic organic compound characterized by a fused pyrrole and thiazole ring system, which contributes to its unique chemical properties. The presence of a hydroxymethyl group at the 5-position enhances its reactivity and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The compound's molecular framework allows for various functionalizations, which can lead to derivatives with tailored properties. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Overall, 4H-Pyrrolo[2,3-d]thiazole-5-methanol represents a versatile scaffold for further exploration in synthetic and medicinal chemistry.
Formula:C6H6N2OS
InChI:InChI=1S/C6H6N2OS/c9-2-4-1-5-6(8-4)7-3-10-5/h1,3,8-9H,2H2
InChI key:InChIKey=RYQKGOARQDSSPV-UHFFFAOYSA-N
SMILES:C(O)C1=CC2=C(N1)N=CS2
Synonyms:
  • [4H-Pyrrolo[2,3-d][1,3]thiazol-5-yl]methanol
  • (4H-Pyrrolo[2,3-d]thiazol-5-yl)methanol
  • 4H-Pyrrolo[2,3-d]thiazole-5-methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.