CAS 132740-59-1
:1-(1-Methylethyl)-4-piperidineethanamine
Description:
1-(1-Methylethyl)-4-piperidineethanamine, also known by its CAS number 132740-59-1, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features an ethylamine side chain, contributing to its amine functionality. It is typically classified as a tertiary amine due to the presence of three carbon-containing groups attached to the nitrogen atom. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, which can influence its solubility in organic solvents compared to water. The compound may exhibit biological activity, potentially interacting with various receptors or enzymes, making it of interest in medicinal chemistry and pharmacology. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the environment in which it is studied. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H22N2
InChI:InChI=1S/C10H22N2/c1-9(2)12-7-4-10(3-6-11)5-8-12/h9-10H,3-8,11H2,1-2H3
InChI key:InChIKey=MWNKNYOIYZJMTH-UHFFFAOYSA-N
SMILES:C(C)(C)N1CCC(CCN)CC1
Synonyms:- 2-(1-Propan-2-ylpiperidin-4-yl)ethanamine
- 1-(1-Methylethyl)-4-piperidineethanamine
- 4-Piperidineethanamine, 1-(1-methylethyl)-
- 2-[1-(Propan-2-yl)piperidin-4-yl]ethan-1-amine
- 2-(1-Isopropylpiperidin-4-yl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
