
CAS 13275-19-9
:1,1,1,3-Tetrachlorobutane
Description:
1,1,1,3-Tetrachlorobutane is a chlorinated organic compound characterized by its four chlorine atoms attached to a four-carbon butane backbone. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is known for its high density and low volatility, making it less likely to evaporate quickly. The presence of multiple chlorine atoms contributes to its chemical stability and hydrophobic nature, which can affect its solubility in water, rendering it more soluble in organic solvents. 1,1,1,3-Tetrachlorobutane is primarily used in industrial applications, including as a solvent and in the synthesis of other chemical compounds. However, due to its chlorinated nature, it may pose environmental and health risks, including potential toxicity and bioaccumulation. Proper handling and disposal are essential to mitigate these risks. As with many chlorinated hydrocarbons, it is subject to regulatory scrutiny due to concerns about its environmental impact and potential effects on human health.
Formula:C4H6Cl4
InChI:InChI=1S/C4H6Cl4/c1-3(5)2-4(6,7)8/h3H,2H2,1H3
InChI key:InChIKey=VNCIRZZEHCGAQP-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)Cl)C(C)Cl
Synonyms:- Butane, 1,1,1,3-tetrachloro-
- 1,1,1,3-Tetrachlorobutane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
