CAS 13275-42-8
:2-(2-Bromophenyl)-1H-benzimidazole
Description:
2-(2-Bromophenyl)-1H-benzimidazole, with the CAS number 13275-42-8, is an organic compound characterized by its fused benzene and imidazole rings, which contribute to its aromatic properties. This compound features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, enhancing its reactivity and potential for substitution reactions. The benzimidazole moiety is known for its biological activity, often exhibiting properties such as antimicrobial and antifungal effects. The presence of the bromine atom can also influence the compound's solubility and stability in various solvents. Typically, compounds like this may be utilized in pharmaceutical research and development due to their potential therapeutic applications. Additionally, the molecular structure allows for various synthetic modifications, making it a versatile building block in organic synthesis. Overall, 2-(2-Bromophenyl)-1H-benzimidazole is notable for its unique structural features and potential applications in medicinal chemistry.
Formula:C13H9BrN2
InChI:InChI=1S/C13H9BrN2/c14-10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)16-13/h1-8H,(H,15,16)
InChI key:InChIKey=KOXRUUGKLDCECO-UHFFFAOYSA-N
SMILES:BrC1=C(C=2NC=3C(N2)=CC=CC3)C=CC=C1
Synonyms:- 1H-benzimidazole, 2-(2-bromophenyl)-
- 2-(2-Bromophenyl)-1H-1,3-benzodiazole
- 2-(2-Bromophenyl)-1H-benzo[d]imidazole
- 2-(2-Bromophenyl)benzimidazole
- Benzimidazole, 2-(o-bromophenyl)-
- G 641
- G 641 (biocide)
- NSC 128738
- 2-(2-Bromophenyl)-1H-benzimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(2-Bromophenyl)-1h-1,3-benzodiazole
CAS:Formula:C13H9BrN2Purity:98%Color and Shape:SolidMolecular weight:273.12802-(2-Bromophenyl)-1H-benzo[d]imidazole
CAS:2-(2-Bromophenyl)-1H-benzo[d]imidazolePurity:99%Molecular weight:273.13g/mol2-(2-Bromophenyl)-1H-benzimidazole
CAS:Formula:C13H9BrN2Purity:>98.0%(GC)(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:273.132-(2-Bromophenyl)-1H-benzimidazole
CAS:2-(2-Bromophenyl)-1H-benzimidazole is a halogenated aromatic compound that has been used in electrochemical studies. It can be synthesized by the reaction of bromine with 2,4-dinitrobenzene. The compound exhibits a number of functional groups including nitro and bromo groups. One of the most notable properties of this compound is its ability to act as an efficient electrocatalyst for the reduction of chloride ions to hydrogen gas. 2-(2-Bromophenyl)-1H-benzimidazole also has potentiodynamic polarization properties and has been shown to catalyze the reduction of a number of organic compounds including propane, butane, pentane, hexane and heptane. This compound is also used in microscopy simulations to study unsymmetrical molecules.Formula:C13H9BrN2Purity:Min. 95%Molecular weight:273.13 g/mol




