
CAS 13275-79-1
:2-Chloro-N-(1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)acetamide
Description:
2-Chloro-N-(1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)acetamide, with CAS number 13275-79-1, is a chemical compound that features a chloro substituent and a pyrimidine-derived structure. This compound is characterized by its complex molecular framework, which includes a tetrahydro structure and multiple functional groups, such as an amide and a dioxo moiety. The presence of the chloro group suggests potential reactivity, making it useful in various chemical syntheses or as an intermediate in pharmaceutical applications. The tetrahydro-1,3-dimethyl component indicates that it may exhibit specific stereochemical properties, influencing its biological activity. Additionally, the dioxo groups contribute to the compound's potential for hydrogen bonding and interactions with biological targets. Overall, this compound's unique structural features may provide avenues for research in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its physical properties, reactivity, and biological effects would be necessary to fully understand its applications and safety profile.
Formula:C8H10ClN3O3
InChI:InChI=1S/C8H10ClN3O3/c1-11-4-5(10-6(13)3-9)7(14)12(2)8(11)15/h4H,3H2,1-2H3,(H,10,13)
InChI key:InChIKey=KNRKZSGFQJBIOL-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C=1C(=O)N(C)C(=O)N(C)C1
Synonyms:- 2-Chloro-N-(1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)acetamide
- 2-Chloro-N-(1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)acetamide
- Acetamide, 2-chloro-N-(1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)-
- NSC 76460
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetamide, 2-chloro-N-(1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)-
CAS:Formula:C8H10ClN3O3Molecular weight:231.6363
