CAS 13276-08-9
:N-Octadecyloctadecanamide
Description:
N-Octadecyloctadecanamide, also known as stearamide, is a long-chain fatty amide derived from octadecanoic acid (stearic acid). This compound features a hydrophobic hydrocarbon chain, which contributes to its surfactant properties and makes it useful in various applications. It is typically a white, waxy solid at room temperature, exhibiting low solubility in water due to its nonpolar characteristics, but it is soluble in organic solvents such as chloroform and ethanol. N-Octadecyloctadecanamide is known for its thermal stability and can act as a lubricant, plasticizer, and emulsifier in industrial processes. Additionally, it has applications in the formulation of cosmetics and personal care products, where it can enhance texture and stability. Its chemical structure allows it to interact with both hydrophobic and hydrophilic substances, making it versatile in formulations. Safety data indicates that it is generally considered to have low toxicity, but standard handling precautions should be observed to minimize exposure.
Formula:C36H73NO
InChI:InChI=1/C36H73NO/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-35(36(37)38)33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h35H,3-34H2,1-2H3,(H2,37,38)
InChI key:InChIKey=DJWFNQUDPJTSAD-UHFFFAOYSA-N
SMILES:N(C(CCCCCCCCCCCCCCCCC)=O)CCCCCCCCCCCCCCCCCC
Synonyms:- 2-Hexadecylicosanamide
- Alflow 80
- Kemamide S 180
- N-Octadecylstearamide
- N-Stearylstearamide
- N-Stearylstearic acid amide
- N-octadecyloctadecanamide
- Nikka Amide S
- Nikkamide S
- Octadecanamide, N-octadecyl-
- S 180
- S 180 (amide)
- Stearylstearamide
- N-Octadecylstearamid
- Octadecyl stearamide
- n-octadecyl-octadecanamid
- N-octadecyl-Octadecanamiden-octadecyl-octadecanamidstearylstearamide
- N-octadecyl-Octadecanamiden-octadecyl-octadecanamidstearylstearamide Octadecanamide,N-octadecyl-
- Stearylstearamid
- Stearyl Stearmide
- Stearyl stearamide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-Octadecyloctadecanamide
CAS:<p>Octadecyloctadecanamide is an aliphatic amide that is a high molecular weight molecule. It has been used as a viscosity modifier, and as a component of ethylene diamine in the production of synthetic detergent compositions. Octadecyloctadecanamide has been shown to be effective in preventing metal corrosion due to its ability to form hydrogen bonds with the surface of metals. Octadecyloctadecanamide also has hydroxyl groups that can react with fatty acids and fatty esters. This leads to the formation of polymer films that are stable in water and are able to act as detergents for chromatographic science applications.</p>Formula:C36H73NOPurity:Min. 95%Molecular weight:535.97 g/mol

