CAS 13276-24-9

4-Morpholineethanol, 4-acetate

Description:

4-Morpholineethanol, 4-acetate, also known by its CAS number 13276-24-9, is an organic compound characterized by the presence of a morpholine ring and an acetate functional group. This substance typically appears as a colorless to pale yellow liquid and is soluble in water due to the presence of both polar morpholine and acetate groups. It exhibits properties that make it useful in various applications, including as a solvent, a chemical intermediate, and potentially in pharmaceutical formulations. The morpholine moiety contributes to its basicity, while the acetate group can participate in esterification reactions. Additionally, 4-Morpholineethanol, 4-acetate may exhibit mild toxicity, necessitating careful handling and appropriate safety measures during use. Its chemical structure allows for hydrogen bonding, which influences its physical properties such as boiling point and viscosity. Overall, this compound is of interest in both industrial and research settings, particularly in the synthesis of more complex molecules.

Formula: C₈H₁₅NO₃

InChI: InChI=1S/C8H15NO3/c1-8(10)12-7-4-9-2-5-11-6-3-9/h2-7H2,1H3

InChI key: InChIKey=ZDTRMJAWAIZCSV-UHFFFAOYSA-N

SMILES: C(COC(C)=O)N1CCOCC1

Synonyms:

• 4-Morpholineethanol, acetate (ester)
• 4-Morpholineethanol, acetate
• 4-Morpholineethanol, 4-acetate