CAS 13276-52-3
:2,6-Dichloropurine riboside
Description:
2,6-Dichloropurine riboside is a nucleoside analog characterized by its structural components, which include a purine base (2,6-dichloropurine) linked to a ribose sugar. This compound is notable for its potential antiviral and anticancer properties, as it can interfere with nucleic acid synthesis. The presence of chlorine atoms at the 2 and 6 positions of the purine ring enhances its biological activity and alters its interaction with enzymes involved in nucleic acid metabolism. 2,6-Dichloropurine riboside is typically soluble in polar solvents, reflecting the hydrophilic nature of the ribose moiety. Its chemical behavior is influenced by the presence of the ribose sugar, which allows it to participate in biochemical pathways similar to natural nucleosides. This compound is of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents targeting viral infections and certain types of cancer. Safety and handling precautions are essential when working with this substance, as with many chemical compounds, due to its potential biological effects.
Formula:C10H10Cl2N4O4
InChI:InChI=1/C10H10Cl2N4O4/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2
SMILES:C(C1C(C(C(n2cnc3c(Cl)nc(Cl)nc23)O1)O)O)O
Synonyms:- 2,6-dichloro-9-pentofuranosyl-9H-purine
- 2,6-Dichloro-9-(beta-D-ribofuranosyl)purine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
9H-Purine, 2,6-dichloro-9-β-D-ribofuranosyl-
CAS:Formula:C10H10Cl2N4O4Purity:95%Color and Shape:SolidMolecular weight:321.11682,6-Dichloropurine-9-β-D-riboside
CAS:2,6-Dichloropurine-9-β-D-riboside is a building block.1,2It has been used in the synthesis of photoaffinity probes for nucleotide binding sites in proteins.Formula:C10H10Cl2N4O4Color and Shape:White To Off-White SolidMolecular weight:321.12(2R,3R,4S,5R)-2-(2,6-Dichloro-9H-Purin-9-Yl)-5-(Hydroxymethyl)Tetrahydrofuran-3,4-Diol
CAS:(2R,3R,4S,5R)-2-(2,6-Dichloro-9H-Purin-9-Yl)-5-(Hydroxymethyl)Tetrahydrofuran-3,4-DiolPurity:97%Molecular weight:321.12g/mol2,6-Dichloro-9-(β-D-ribofuranosyl)purine
CAS:2,6-Dichloro-9-(β-D-ribofuranosyl)purine is a nucleoside analog composed of a modified purine base and a ribose sugar. It has possible applications as an intermediate in nucleoside chemistry, particularly for the synthesis of functionalized purine nucleosides used in biological and pharmaceutical research.Formula:C10H10Cl2N4O4Purity:Min. 95%Color and Shape:PowderMolecular weight:321.12 g/mol2,6-Dichloropurineriboside
CAS:Formula:C10H10Cl2N4O4Purity:95%Color and Shape:SolidMolecular weight:321.112,6-Dichloropurine-9-β-D-riboside
CAS:Controlled ProductApplications 2,6-Dichloropurine-9-β-D-riboside (cas# 13276-52-3) is a compound useful in organic synthesis.
Formula:C10H10Cl2N4O4Color and Shape:NeatMolecular weight:321.12








